CAS 5152-94-3 is the registry number for 4,4-Di-phenyl-tetrathiafulvalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z)-4-phenyl-2-(4-phenyl-1,3-dithiol-2-ylidene)-1,3-dithiole (CAS 5152-94-3) is a chemical compound with the molecular formula C18H12S4 and a molecular weight of 356.6 g/mol. IUPAC name: (2Z)-4-phenyl-2-(4-phenyl-1,3-dithiol-2-ylidene)-1,3-dithiole. InChIKey: UXYULNILNJCKTO-ZCXUNETKSA-N.
| Molecular formula | C18H12S4 |
|---|---|
| Molecular weight | 356.6 g/mol |
| IUPAC name | (2Z)-4-phenyl-2-(4-phenyl-1,3-dithiol-2-ylidene)-1,3-dithiole |
| InChIKey | UXYULNILNJCKTO-ZCXUNETKSA-N |
| SMILES | C1=CC=C(C=C1)C2=CS/C(=C/3\SC=C(S3)C4=CC=CC=C4)/S2 |
Computed by PubChem (NCBI)