CAS 1393803-55-8 is the registry number for 6–Chloro–3–hydroxybenzo(b)thiophene–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
6-chloro-3-hydroxy-1-benzothiophene-2-carboxylic acid (CAS 1393803-55-8) is a chemical compound with the molecular formula C9H5ClO3S and a molecular weight of 228.65 g/mol. IUPAC name: 6-chloro-3-hydroxy-1-benzothiophene-2-carboxylic acid. InChIKey: HYDDMVANLIFXSD-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3S |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 6-chloro-3-hydroxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | HYDDMVANLIFXSD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=C2O)C(=O)O |
Computed by PubChem (NCBI)