CAS 90407-11-7 appears in our catalog under these names: 7-Chloro-3-hydroxybenzo[b]thiophene-2-carboxylic acid, 95%, 7–Chloro–3–hydroxybenzo(b)thiophene–2–carboxylic acid, 7-Chloro-3-hydroxybenzo[b]thiophene-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
7-chloro-3-hydroxy-1-benzothiophene-2-carboxylic acid (CAS 90407-11-7) is a chemical compound with the molecular formula C9H5ClO3S and a molecular weight of 228.65 g/mol. IUPAC name: 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylic acid. InChIKey: HBPQOGJGBCVXPV-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3S |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | HBPQOGJGBCVXPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=C2O)C(=O)O |
Computed by PubChem (NCBI)