CAS 1394040-65-3 appears in our catalog under these names: 6-Methanesulfonyl-3,4-dihydro-2H-1,4-benzoxazine, 95%, 6-Methanesulfonyl-3,4-dihydro-2H-1,4-benzoxazine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-methylsulfonyl-3,4-dihydro-2H-1,4-benzoxazine (CAS 1394040-65-3) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: 6-methylsulfonyl-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: QHVACRHIDUXKNT-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 6-methylsulfonyl-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | QHVACRHIDUXKNT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)OCCN2 |
Computed by PubChem (NCBI)