CAS 1394041-10-1 appears in our catalog under these names: 4-((2,5-Dichlorophenyl)methylidene)piperidine hydrochloride, 95%, 4-((2,5-Dichlorophenyl)methylidene)piperidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-[(2,5-dichlorophenyl)methylidene]piperidine;hydrochloride (CAS 1394041-10-1) is a chemical compound with the molecular formula C12H14Cl3N and a molecular weight of 278.6 g/mol. IUPAC name: 4-[(2,5-dichlorophenyl)methylidene]piperidine;hydrochloride. InChIKey: OBMKBQJQULGECR-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl3N |
|---|---|
| Molecular weight | 278.6 g/mol |
| IUPAC name | 4-[(2,5-dichlorophenyl)methylidene]piperidine;hydrochloride |
| InChIKey | OBMKBQJQULGECR-UHFFFAOYSA-N |
| SMILES | C1CNCCC1=CC2=C(C=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)