CAS 1893070-97-7 is the registry number for 1-(3,4-Dichlorophenyl)-3-azabicyclo(4.1.0)heptane hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
1-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptane;hydrochloride (CAS 1893070-97-7) is a chemical compound with the molecular formula C12H14Cl3N and a molecular weight of 278.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptane;hydrochloride. InChIKey: FFUHBHIDAATEAZ-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl3N |
|---|---|
| Molecular weight | 278.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptane;hydrochloride |
| InChIKey | FFUHBHIDAATEAZ-UHFFFAOYSA-N |
| SMILES | C1CNCC2(C1C2)C3=CC(=C(C=C3)Cl)Cl.Cl |
Computed by PubChem (NCBI)