CAS 1394041-52-1 appears in our catalog under these names: Methyl 2-(6-chloro-3-oxo-(1,2,4)triazolo(4,3-b)pyridazin-2(3H)-yl)acetate, 97%, Methyl 2-{6-chloro-3-oxo-2H,3H-(1,2,4)triazolo(4,3-b)pyridazin-2-yl}acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Methyl 2-(6-chloro-3-oxo-[1,2,4]triazolo[4,3-b]pyridazin-2-yl)acetate (CAS 1394041-52-1) is a chemical compound with the molecular formula C8H7ClN4O3 and a molecular weight of 242.62 g/mol. IUPAC name: methyl 2-(6-chloro-3-oxo-[1,2,4]triazolo[4,3-b]pyridazin-2-yl)acetate. InChIKey: UDMIMFLYNLCVAL-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O3 |
|---|---|
| Molecular weight | 242.62 g/mol |
| IUPAC name | methyl 2-(6-chloro-3-oxo-[1,2,4]triazolo[4,3-b]pyridazin-2-yl)acetate |
| InChIKey | UDMIMFLYNLCVAL-UHFFFAOYSA-N |
| SMILES | COC(=O)CN1C(=O)N2C(=N1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)