CAS 878713-16-7 is the registry number for (6-Chloro-5-methyl-7-oxo-4,7-dihydro-[1,2,4]-triazolo[1,5-a]pyrimidin-2-yl)-acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-chloro-5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid (CAS 878713-16-7) is a chemical compound with the molecular formula C8H7ClN4O3 and a molecular weight of 242.62 g/mol. IUPAC name: 2-(6-chloro-5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid. InChIKey: QMZGDRDIXJTJCK-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O3 |
|---|---|
| Molecular weight | 242.62 g/mol |
| IUPAC name | 2-(6-chloro-5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid |
| InChIKey | QMZGDRDIXJTJCK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)N=C(N2)CC(=O)O)Cl |
Computed by PubChem (NCBI)