Products 1394042-84-2
CAS 1394042-84-2 appears in our catalog under these names: 4-(Dimethylamino)-3-fluorobenzene-1-carboximidamide dihydrochloride, 95%, 4-(Dimethylamino)-3-fluorobenzene-1-carboximidamide dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(dimethylamino)-3-fluorobenzenecarboximidamide;dihydrochloride (CAS 1394042-84-2) is a chemical compound with the molecular formula C9H14Cl2FN3 and a molecular weight of 254.13 g/mol. IUPAC name: 4-(dimethylamino)-3-fluorobenzenecarboximidamide;dihydrochloride. InChIKey: LCNVZTQTSQSRMX-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2FN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 4-(dimethylamino)-3-fluorobenzenecarboximidamide;dihydrochloride |
| InChIKey | LCNVZTQTSQSRMX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C(=N)N)F.Cl.Cl |
Computed by PubChem (NCBI)