CAS 1955547-02-0 appears in our catalog under these names: 1-(5-fluoropyridin-2-yl)piperazine dihydrochloride, 95%, 1-(5-Fluoropyridin-2-yl)piperazine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-(5-fluoro-2-pyridinyl)piperazine;dihydrochloride (CAS 1955547-02-0) is a chemical compound with the molecular formula C9H14Cl2FN3 and a molecular weight of 254.13 g/mol. IUPAC name: 1-(5-fluoro-2-pyridinyl)piperazine;dihydrochloride. InChIKey: NIONQJYXPBFCKX-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2FN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 1-(5-fluoro-2-pyridinyl)piperazine;dihydrochloride |
| InChIKey | NIONQJYXPBFCKX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=C(C=C2)F.Cl.Cl |
Computed by PubChem (NCBI)