Products 1394230-40-0
CAS 1394230-40-0 is the registry number for Methyl vanillate-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Methyl 4-hydroxy-3-(trideuteriomethoxy)benzoate (CAS 1394230-40-0) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 185.19 g/mol. IUPAC name: methyl 4-hydroxy-3-(trideuteriomethoxy)benzoate. InChIKey: BVWTXUYLKBHMOX-FIBGUPNXSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 185.19 g/mol |
| IUPAC name | methyl 4-hydroxy-3-(trideuteriomethoxy)benzoate |
| InChIKey | BVWTXUYLKBHMOX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C(=O)OC)O |
Computed by PubChem (NCBI)