Products 1394284-79-7
CAS 1394284-79-7 is the registry number for Methyl 4-(3-(2-bromophenyl)-3-oxoprop-1-yn-1-yl)benzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
Methyl 4-[3-(2-bromophenyl)-3-oxoprop-1-ynyl]benzoate (CAS 1394284-79-7) is a chemical compound with the molecular formula C17H11BrO3 and a molecular weight of 343.2 g/mol. IUPAC name: methyl 4-[3-(2-bromophenyl)-3-oxoprop-1-ynyl]benzoate. InChIKey: JOFQYBSLDQPARD-UHFFFAOYSA-N.
| Molecular formula | C17H11BrO3 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | methyl 4-[3-(2-bromophenyl)-3-oxoprop-1-ynyl]benzoate |
| InChIKey | JOFQYBSLDQPARD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C#CC(=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)