CAS 20005-36-1 is the registry number for 3-(5-(4-Bromophenyl)furan-2-yl)-1-(furan-2-yl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[5-(4-bromophenyl)furan-2-yl]-1-(furan-2-yl)prop-2-en-1-one (CAS 20005-36-1) is a chemical compound with the molecular formula C17H11BrO3 and a molecular weight of 343.2 g/mol. IUPAC name: (E)-3-[5-(4-bromophenyl)furan-2-yl]-1-(furan-2-yl)prop-2-en-1-one. InChIKey: ORSYIVDUJLVHHP-VQHVLOKHSA-N.
| Molecular formula | C17H11BrO3 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-1-(furan-2-yl)prop-2-en-1-one |
| InChIKey | ORSYIVDUJLVHHP-VQHVLOKHSA-N |
| SMILES | C1=COC(=C1)C(=O)/C=C/C2=CC=C(O2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)