Products 139435-18-0
CAS 139435-18-0 appears in our catalog under these names: D6-(±)-Jasmonic acid methyl ester (99.2 ATOM% D), D6-(±)-Jasmonic acid methyl ester. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x5mg.
Methyl 2-[(1S,2S)-2-[(Z)-3,4,4,5,5,5-hexadeuteriopent-2-enyl]-3-oxocyclopentyl]acetate (CAS 139435-18-0) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 230.33 g/mol. IUPAC name: methyl 2-[(1S,2S)-2-[(Z)-3,4,4,5,5,5-hexadeuteriopent-2-enyl]-3-oxocyclopentyl]acetate. InChIKey: GEWDNTWNSAZUDX-RMWDPJGOSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | methyl 2-[(1S,2S)-2-[(Z)-3,4,4,5,5,5-hexadeuteriopent-2-enyl]-3-oxocyclopentyl]acetate |
| InChIKey | GEWDNTWNSAZUDX-RMWDPJGOSA-N |
| SMILES | [2H]/C(=C/C[C@H]1[C@@H](CCC1=O)CC(=O)OC)/C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)