Products 1663-61-2
CAS 1663-61-2 appears in our catalog under these names: Triethyl orthobenzoate, 97%, Triethyl Orthobenzoate, >95% (GC), Triethyl Orthobenzoate, Triethyl orthobenzoate, Triethyl Orthobenzoate, >97.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 500g, 25g, 5g, 1g, 2,5g, 250mg, 250g.
Triethoxymethylbenzene (CAS 1663-61-2) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: triethoxymethylbenzene. InChIKey: BQFPCTXLBRVFJL-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | triethoxymethylbenzene |
| InChIKey | BQFPCTXLBRVFJL-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CC=CC=C1)(OCC)OCC |
Computed by PubChem (NCBI)