CAS 1394668-81-5 is the registry number for N-(4-(Carbamimidoylmethoxy)phenyl)-2-methylpropanamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[4-(2-amino-2-iminoethoxy)phenyl]-2-methylpropanamide;hydrochloride (CAS 1394668-81-5) is a chemical compound with the molecular formula C12H18ClN3O2 and a molecular weight of 271.74 g/mol. IUPAC name: N-[4-(2-amino-2-iminoethoxy)phenyl]-2-methylpropanamide;hydrochloride. InChIKey: YRVMEWOLIOZBFV-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3O2 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | N-[4-(2-amino-2-iminoethoxy)phenyl]-2-methylpropanamide;hydrochloride |
| InChIKey | YRVMEWOLIOZBFV-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC=C(C=C1)OCC(=N)N.Cl |
Computed by PubChem (NCBI)