Products 60240-16-6
CAS 60240-16-6 appears in our catalog under these names: H–Ala–Phe–NH₂ · HCl, H-Ala-Phe-NH2·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 1000mg, 5000mg.
(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanamide;hydrochloride (CAS 60240-16-6) is a chemical compound with the molecular formula C12H18ClN3O2 and a molecular weight of 271.74 g/mol. IUPAC name: (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanamide;hydrochloride. InChIKey: ZBPKZDKCUDGUCQ-GNAZCLTHSA-N.
| Molecular formula | C12H18ClN3O2 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanamide;hydrochloride |
| InChIKey | ZBPKZDKCUDGUCQ-GNAZCLTHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N)N.Cl |
Computed by PubChem (NCBI)