CAS 1394716-69-8 appears in our catalog under these names: {1H,1aH,6H,6aH-cyclopropa(a)inden-1-yl}methanamine hydrochloride, 95%, 1H,1aH,6H,6aH-Cyclopropa(A)inden-1-ylmethanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethanamine;hydrochloride (CAS 1394716-69-8) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethanamine;hydrochloride. InChIKey: HQKMYZGORCQFFJ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethanamine;hydrochloride |
| InChIKey | HQKMYZGORCQFFJ-UHFFFAOYSA-N |
| SMILES | C1C2C(C2C3=CC=CC=C31)CN.Cl |
Computed by PubChem (NCBI)