CAS 1394738-31-8 is the registry number for Benzyl 3-sulfamoylpropanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Benzyl 3-sulfamoylpropanoate (CAS 1394738-31-8) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: benzyl 3-sulfamoylpropanoate. InChIKey: AJSGWPZFURVXCO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | benzyl 3-sulfamoylpropanoate |
| InChIKey | AJSGWPZFURVXCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCS(=O)(=O)N |
Computed by PubChem (NCBI)