CAS 1394793-59-9 is the registry number for 3-Bromo-5-nitro-N-(1-(thiazol-2-yl)ethyl)pyridin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-nitro-N-[1-(1,3-thiazol-2-yl)ethyl]pyridin-2-amine (CAS 1394793-59-9) is a chemical compound with the molecular formula C10H9BrN4O2S and a molecular weight of 329.18 g/mol. IUPAC name: 3-bromo-5-nitro-N-[1-(1,3-thiazol-2-yl)ethyl]pyridin-2-amine. InChIKey: OHOKVBOXSOVAAG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN4O2S |
|---|---|
| Molecular weight | 329.18 g/mol |
| IUPAC name | 3-bromo-5-nitro-N-[1-(1,3-thiazol-2-yl)ethyl]pyridin-2-amine |
| InChIKey | OHOKVBOXSOVAAG-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=CS1)NC2=C(C=C(C=N2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)