CAS 466656-34-8 is the registry number for CDA-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (CAS 466656-34-8) is a chemical compound with the molecular formula C10H9BrN4O2S and a molecular weight of 329.18 g/mol. IUPAC name: 4-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione. InChIKey: MOXJTJWMELWCKT-YIXHJXPBSA-N.
| Molecular formula | C10H9BrN4O2S |
|---|---|
| Molecular weight | 329.18 g/mol |
| IUPAC name | 4-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| InChIKey | MOXJTJWMELWCKT-YIXHJXPBSA-N |
| SMILES | COC1=C(C(=CC(=C1)/C=N/N2C=NNC2=S)Br)O |
Computed by PubChem (NCBI)