CAS 1394917-55-5 is the registry number for 3-Hydroxybenzene-1-sulfonyl fluoride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-hydroxybenzenesulfonyl fluoride (CAS 1394917-55-5) is a chemical compound with the molecular formula C6H5FO3S and a molecular weight of 176.17 g/mol. IUPAC name: 3-hydroxybenzenesulfonyl fluoride. InChIKey: DMSYHTZFGNDODA-UHFFFAOYSA-N.
| Molecular formula | C6H5FO3S |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-hydroxybenzenesulfonyl fluoride |
| InChIKey | DMSYHTZFGNDODA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)O |
Computed by PubChem (NCBI)