Products 1394917-55-5

CAS 1394917-55-5 is the registry number for 3-Hydroxybenzene-1-sulfonyl fluoride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3-hydroxybenzenesulfonyl fluoride (CAS 1394917-55-5) is a chemical compound with the molecular formula C6H5FO3S and a molecular weight of 176.17 g/mol. IUPAC name: 3-hydroxybenzenesulfonyl fluoride. InChIKey: DMSYHTZFGNDODA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5FO3S
Molecular weight176.17 g/mol
IUPAC name3-hydroxybenzenesulfonyl fluoride
InChIKeyDMSYHTZFGNDODA-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)F)O

Computed by PubChem (NCBI)