CAS 71517-69-6 appears in our catalog under these names: 2-Hydroxybenzene-1-sulfonyl fluoride, 95%, 2-Hydroxybenzene-1-sulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-hydroxybenzenesulfonyl fluoride (CAS 71517-69-6) is a chemical compound with the molecular formula C6H5FO3S and a molecular weight of 176.17 g/mol. IUPAC name: 2-hydroxybenzenesulfonyl fluoride. InChIKey: SYOXQXBDBLELRK-UHFFFAOYSA-N.
| Molecular formula | C6H5FO3S |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-hydroxybenzenesulfonyl fluoride |
| InChIKey | SYOXQXBDBLELRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)O)S(=O)(=O)F |
Computed by PubChem (NCBI)