CAS 1394957-71-1 appears in our catalog under these names: (4AR,9aS)-6-bromo-4-hydroxy-4,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3(2H)-one, 98%, (R,S)-BODE KINETIC RESOLUTION CATALYST. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
(4aR,9aS)-6-bromo-4-hydroxy-9,9a-dihydro-4aH-indeno[2,1-b][1,4]oxazin-3-one (CAS 1394957-71-1) is a chemical compound with the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. IUPAC name: (4aR,9aS)-6-bromo-4-hydroxy-9,9a-dihydro-4aH-indeno[2,1-b][1,4]oxazin-3-one. InChIKey: FQXSUQCCAHKURK-GXSJLCMTSA-N.
| Molecular formula | C11H10BrNO3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | (4aR,9aS)-6-bromo-4-hydroxy-9,9a-dihydro-4aH-indeno[2,1-b][1,4]oxazin-3-one |
| InChIKey | FQXSUQCCAHKURK-GXSJLCMTSA-N |
| SMILES | C1[C@H]2[C@@H](C3=C1C=CC(=C3)Br)N(C(=O)CO2)O |
Computed by PubChem (NCBI)