Products 401462-74-6
CAS 401462-74-6 appears in our catalog under these names: 5-Bromo-2-[(cyclopropylcarbonyl)amino]benzoic acid, 95%, 5-Bromo-2-((cyclopropylcarbonyl)amino)benzoic Acid, 95+%, 5-Bromo-2-[(cyclopropylcarbonyl)amino]benzoic Acid, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-bromo-2-(cyclopropanecarbonylamino)benzoic acid (CAS 401462-74-6) is a chemical compound with the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. IUPAC name: 5-bromo-2-(cyclopropanecarbonylamino)benzoic acid. InChIKey: AKDQATMQWYORNA-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 5-bromo-2-(cyclopropanecarbonylamino)benzoic acid |
| InChIKey | AKDQATMQWYORNA-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=C(C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)