Products 923130-78-3
CAS 923130-78-3 appears in our catalog under these names: 1-(2-Bromophenyl)-5-oxopyrrolidine-3-carboxylic acid, 98%, 1-(2-Bromophenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100mg, 250mg.
1-(2-bromophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 923130-78-3) is a chemical compound with the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. IUPAC name: 1-(2-bromophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: PQRRNWXQURZXGP-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 1-(2-bromophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | PQRRNWXQURZXGP-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC=C2Br)C(=O)O |
Computed by PubChem (NCBI)