Products 1395038-43-3
CAS 1395038-43-3 is the registry number for 1,4-Dichloro-2-fluoro-3-(propan-2-yloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,4-dichloro-2-fluoro-3-propan-2-yloxybenzene (CAS 1395038-43-3) is a chemical compound with the molecular formula C9H9Cl2FO and a molecular weight of 223.07 g/mol. IUPAC name: 1,4-dichloro-2-fluoro-3-propan-2-yloxybenzene. InChIKey: ANNAFPZEVZCIJH-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2FO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 1,4-dichloro-2-fluoro-3-propan-2-yloxybenzene |
| InChIKey | ANNAFPZEVZCIJH-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1F)Cl)Cl |
Computed by PubChem (NCBI)