CAS 2734776-53-3 is the registry number for 2,2-Dichloro-1-(4-fluoro-2-methylphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(4-fluoro-2-methylphenyl)ethanol (CAS 2734776-53-3) is a chemical compound with the molecular formula C9H9Cl2FO and a molecular weight of 223.07 g/mol. IUPAC name: 2,2-dichloro-1-(4-fluoro-2-methylphenyl)ethanol. InChIKey: WDKKNEPYCAYYMA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2FO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 2,2-dichloro-1-(4-fluoro-2-methylphenyl)ethanol |
| InChIKey | WDKKNEPYCAYYMA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C(C(Cl)Cl)O |
Computed by PubChem (NCBI)