CAS 1395493-48-7 is the registry number for 3-((4-(2-Methoxyphenyl)-2-pyridinyl)amino)-benzenemethanesulfonamide. Offered by: TRC. Available pack sizes: 25mg.
[3-[[4-(2-methoxyphenyl)-2-pyridinyl]amino]phenyl]methanesulfonamide (CAS 1395493-48-7) is a chemical compound with the molecular formula C19H19N3O3S and a molecular weight of 369.4 g/mol. IUPAC name: [3-[[4-(2-methoxyphenyl)-2-pyridinyl]amino]phenyl]methanesulfonamide. InChIKey: WIMRMIUJTYQVQS-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O3S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | [3-[[4-(2-methoxyphenyl)-2-pyridinyl]amino]phenyl]methanesulfonamide |
| InChIKey | WIMRMIUJTYQVQS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC(=NC=C2)NC3=CC=CC(=C3)CS(=O)(=O)N |
Computed by PubChem (NCBI)