Products 2428631-67-6
CAS 2428631-67-6 is the registry number for Febuxostat Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[3,5-dicyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (CAS 2428631-67-6) is a chemical compound with the molecular formula C19H19N3O3S and a molecular weight of 369.4 g/mol. IUPAC name: ethyl 2-[3,5-dicyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: NBDWTOVTMHXXJK-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O3S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | ethyl 2-[3,5-dicyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | NBDWTOVTMHXXJK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=CC(=C(C(=C2)C#N)OCC(C)C)C#N)C |
Computed by PubChem (NCBI)