CAS 1395786-40-9 appears in our catalog under these names: N2-(4-Aminophenyl)-N4,N4,6-trimethylpyrimidine-2,4-diamine 98%, N2-(4-aminophenyl)-N4,N4,6-trimethylpyrimidine-2,4-diamine, 98%, 98%, N~2~-(4-aminophenyl)-N~4~,N~4~,6-trimethylpyrimidine-2,4-diamine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-N-(4-aminophenyl)-4-N,4-N,6-trimethylpyrimidine-2,4-diamine (CAS 1395786-40-9) is a chemical compound with the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. IUPAC name: 2-N-(4-aminophenyl)-4-N,4-N,6-trimethylpyrimidine-2,4-diamine. InChIKey: LYQRHCXHOCPMFZ-UHFFFAOYSA-N.
| Molecular formula | C13H17N5 |
|---|---|
| Molecular weight | 243.31 g/mol |
| IUPAC name | 2-N-(4-aminophenyl)-4-N,4-N,6-trimethylpyrimidine-2,4-diamine |
| InChIKey | LYQRHCXHOCPMFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC2=CC=C(C=C2)N)N(C)C |
Computed by PubChem (NCBI)