Products 1706419-07-9
CAS 1706419-07-9 is the registry number for N4-(4-Aminophenyl)-N6,N6,2-trimethylpyrimidine-4,6-diamine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
6-N-(4-aminophenyl)-4-N,4-N,2-trimethylpyrimidine-4,6-diamine (CAS 1706419-07-9) is a chemical compound with the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. IUPAC name: 6-N-(4-aminophenyl)-4-N,4-N,2-trimethylpyrimidine-4,6-diamine. InChIKey: PUGSPBNIJIPSDU-UHFFFAOYSA-N.
| Molecular formula | C13H17N5 |
|---|---|
| Molecular weight | 243.31 g/mol |
| IUPAC name | 6-N-(4-aminophenyl)-4-N,4-N,2-trimethylpyrimidine-4,6-diamine |
| InChIKey | PUGSPBNIJIPSDU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)N(C)C)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)