CAS 13958-40-2 is the registry number for Oxiramide. Offered by: TRC. Available pack sizes: 250mg.
(2R)-N-[4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]butyl]-2-phenoxy-2-phenylacetamide (CAS 13958-40-2) is a chemical compound with the molecular formula C25H34N2O2 and a molecular weight of 394.5 g/mol. IUPAC name: (2R)-N-[4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]butyl]-2-phenoxy-2-phenylacetamide. InChIKey: DTOKETCXTCHCDD-ZFGGDYGUSA-N.
| Molecular formula | C25H34N2O2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | (2R)-N-[4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]butyl]-2-phenoxy-2-phenylacetamide |
| InChIKey | DTOKETCXTCHCDD-ZFGGDYGUSA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1CCCCNC(=O)[C@@H](C2=CC=CC=C2)OC3=CC=CC=C3)C |
Computed by PubChem (NCBI)