Products 344790-81-4

CAS 344790-81-4 is the registry number for tert-Butyl 4-[(3,3-diphenylpropyl)amino]-1-piperidine carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(3,3-diphenylpropylamino)piperidine-1-carboxylate (CAS 344790-81-4) is a chemical compound with the molecular formula C25H34N2O2 and a molecular weight of 394.5 g/mol. IUPAC name: tert-butyl 4-(3,3-diphenylpropylamino)piperidine-1-carboxylate. InChIKey: SWSLZAOTKYXATJ-UHFFFAOYSA-N.

Identity
Molecular formulaC25H34N2O2
Molecular weight394.5 g/mol
IUPAC nametert-butyl 4-(3,3-diphenylpropylamino)piperidine-1-carboxylate
InChIKeySWSLZAOTKYXATJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)NCCC(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)