CAS 2580113-52-4 is the registry number for Boc-D-Val-D-Ala-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[[(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoic acid (CAS 2580113-52-4) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: (2R)-2-[[(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoic acid. InChIKey: FHBCSPANXVQYCP-RKDXNWHRSA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2R)-2-[[(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoic acid |
| InChIKey | FHBCSPANXVQYCP-RKDXNWHRSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)[C@@H](C(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)