CAS 1396503-81-3 appears in our catalog under these names: 4-Bromo-2-fluoro-6-(methylamino)nitrobenzene, 95%, 5-Bromo-3-fluoro-N-methyl-2-nitroaniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg, 25g.
5-bromo-3-fluoro-N-methyl-2-nitroaniline (CAS 1396503-81-3) is a chemical compound with the molecular formula C7H6BrFN2O2 and a molecular weight of 249.04 g/mol. IUPAC name: 5-bromo-3-fluoro-N-methyl-2-nitroaniline. InChIKey: KIXQETVBXAMCLX-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2O2 |
|---|---|
| Molecular weight | 249.04 g/mol |
| IUPAC name | 5-bromo-3-fluoro-N-methyl-2-nitroaniline |
| InChIKey | KIXQETVBXAMCLX-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=CC(=C1)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)