CAS 1695495-70-5 appears in our catalog under these names: 3-Bromo-4-fluoro-6-methyl-2-nitroaniline, 95%, 3-Bromo-4-fluoro-6-methyl-2-nitroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
3-bromo-4-fluoro-6-methyl-2-nitroaniline (CAS 1695495-70-5) is a chemical compound with the molecular formula C7H6BrFN2O2 and a molecular weight of 249.04 g/mol. IUPAC name: 3-bromo-4-fluoro-6-methyl-2-nitroaniline. InChIKey: JKQWGMJSCOMKPS-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2O2 |
|---|---|
| Molecular weight | 249.04 g/mol |
| IUPAC name | 3-bromo-4-fluoro-6-methyl-2-nitroaniline |
| InChIKey | JKQWGMJSCOMKPS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1N)[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)