CAS 139689-10-4 is the registry number for (S)-SKF-77434. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5S)-5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol (CAS 139689-10-4) is a chemical compound with the molecular formula C19H21NO2 and a molecular weight of 295.4 g/mol. IUPAC name: (5S)-5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol. InChIKey: QBUVZVXIRYFENV-KRWDZBQOSA-N.
| Molecular formula | C19H21NO2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (5S)-5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
| InChIKey | QBUVZVXIRYFENV-KRWDZBQOSA-N |
| SMILES | C=CCN1CCC2=CC(=C(C=C2[C@@H](C1)C3=CC=CC=C3)O)O |
Computed by PubChem (NCBI)