Products 139694-24-9

CAS 139694-24-9 is the registry number for Allyl 3,7-dimethyloct-6-en-1-yl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,6-dimethyl-8-prop-2-enoxyoct-2-ene (CAS 139694-24-9) is a chemical compound with the molecular formula C13H24O and a molecular weight of 196.33 g/mol. IUPAC name: 2,6-dimethyl-8-prop-2-enoxyoct-2-ene. InChIKey: FANQMMZFHNTSOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24O
Molecular weight196.33 g/mol
IUPAC name2,6-dimethyl-8-prop-2-enoxyoct-2-ene
InChIKeyFANQMMZFHNTSOQ-UHFFFAOYSA-N
SMILESCC(CCC=C(C)C)CCOCC=C

Computed by PubChem (NCBI)