CAS 60761-23-1 is the registry number for cis-4-(2,2,6-Trimethylcyclohexyl)butan-2-one. Offered by: TRC. Available pack sizes: 1g.
4-[(1R,6R)-2,2,6-trimethylcyclohexyl]butan-2-one (CAS 60761-23-1) is a chemical compound with the molecular formula C13H24O and a molecular weight of 196.33 g/mol. IUPAC name: 4-[(1R,6R)-2,2,6-trimethylcyclohexyl]butan-2-one. InChIKey: PQCDGQHNORPNBR-ZYHUDNBSSA-N.
| Molecular formula | C13H24O |
|---|---|
| Molecular weight | 196.33 g/mol |
| IUPAC name | 4-[(1R,6R)-2,2,6-trimethylcyclohexyl]butan-2-one |
| InChIKey | PQCDGQHNORPNBR-ZYHUDNBSSA-N |
| SMILES | C[C@@H]1CCCC([C@@H]1CCC(=O)C)(C)C |
Computed by PubChem (NCBI)