CAS 1396966-28-1 appears in our catalog under these names: 2-[(Furan-2-carbonyl)-amino]-3-(4-hydroxy-phenyl)-propionic acid, 95%, 2–(Furan–2–carboxamido)–3–(4–hydroxyphenyl)propanoic acid, 2-(Furan-2-carboxamido)-3-(4-hydroxyphenyl)propionic acid. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-(furan-2-carbonylamino)-3-(4-hydroxyphenyl)propanoic acid (CAS 1396966-28-1) is a chemical compound with the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. IUPAC name: 2-(furan-2-carbonylamino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: QUOPBTWUZBWSAF-UHFFFAOYSA-N.
| Molecular formula | C14H13NO5 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 2-(furan-2-carbonylamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | QUOPBTWUZBWSAF-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)