CAS 312498-19-4 appears in our catalog under these names: 1,3-Dioxo-2-(tetrahydro-furan-2-ylmethyl)-2,3-dihydro-1h-isoindole-5-carboxylic acid, 95%, 1,3-Dioxo-2-(tetrahydro-furan-2-ylmethyl)-2,3-dihydro-1H-isoindole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylic acid (CAS 312498-19-4) is a chemical compound with the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. IUPAC name: 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylic acid. InChIKey: KOVZEKMVDOCSHP-UHFFFAOYSA-N.
| Molecular formula | C14H13NO5 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylic acid |
| InChIKey | KOVZEKMVDOCSHP-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CN2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)