Products 1396966-81-6

CAS 1396966-81-6 is the registry number for N-(4,5-Dihydro-1h-imidazol-2-yl)alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4,5-dihydro-1H-imidazol-2-ylamino)propanoic acid (CAS 1396966-81-6) is a chemical compound with the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. IUPAC name: 2-(4,5-dihydro-1H-imidazol-2-ylamino)propanoic acid. InChIKey: AJSRGDZWHXLRQT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11N3O2
Molecular weight157.17 g/mol
IUPAC name2-(4,5-dihydro-1H-imidazol-2-ylamino)propanoic acid
InChIKeyAJSRGDZWHXLRQT-UHFFFAOYSA-N
SMILESCC(C(=O)O)NC1=NCCN1

Computed by PubChem (NCBI)