CAS 674292-94-5 is the registry number for Proline Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-pyrrolidine-1,2-dicarboxamide (CAS 674292-94-5) is a chemical compound with the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. IUPAC name: (2S)-pyrrolidine-1,2-dicarboxamide. InChIKey: RVEDFFORAVMBLV-BYPYZUCNSA-N.
| Molecular formula | C6H11N3O2 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | (2S)-pyrrolidine-1,2-dicarboxamide |
| InChIKey | RVEDFFORAVMBLV-BYPYZUCNSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)