Products 1397287-39-6
CAS 1397287-39-6 is the registry number for 2-Bromo-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-bromo-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (CAS 1397287-39-6) is a chemical compound with the molecular formula C7H2BrClF3N3 and a molecular weight of 300.46 g/mol. IUPAC name: 2-bromo-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: UHABXLHEHFJCCS-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF3N3 |
|---|---|
| Molecular weight | 300.46 g/mol |
| IUPAC name | 2-bromo-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | UHABXLHEHFJCCS-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=NN2C=C1C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)