CAS 2821786-21-2 is the registry number for 5-Bromo-7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidine (CAS 2821786-21-2) is a chemical compound with the molecular formula C7H2BrClF3N3 and a molecular weight of 300.46 g/mol. IUPAC name: 5-bromo-7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidine. InChIKey: HCKRWISWZABIIL-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF3N3 |
|---|---|
| Molecular weight | 300.46 g/mol |
| IUPAC name | 5-bromo-7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidine |
| InChIKey | HCKRWISWZABIIL-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N2C1=NC(=C2)C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)