Products 139744-19-7

CAS 139744-19-7 is the registry number for Methyl 3-(4-methylphenyl)-2-sulfanylpropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-(4-methylphenyl)-2-sulfanylpropanoate (CAS 139744-19-7) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: methyl 3-(4-methylphenyl)-2-sulfanylpropanoate. InChIKey: IFWYWRLTEURWEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O2S
Molecular weight210.29 g/mol
IUPAC namemethyl 3-(4-methylphenyl)-2-sulfanylpropanoate
InChIKeyIFWYWRLTEURWEQ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)CC(C(=O)OC)S

Computed by PubChem (NCBI)