Products 1398065-71-8
CAS 1398065-71-8 appears in our catalog under these names: (±)-Phenoxybenzamine-d5 HCl (benzyl-2,3,4,5,6-d5), 99 atom % D, min 98% Chemical Purity, Phenoxybenzamine (benzyl-2,3,4,5,6-d5) (hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 5mg.
N-(2-chloroethyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-1-phenoxypropan-2-amine;hydrochloride (CAS 1398065-71-8) is a chemical compound with the molecular formula C18H23Cl2NO and a molecular weight of 345.3 g/mol. IUPAC name: N-(2-chloroethyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-1-phenoxypropan-2-amine;hydrochloride. InChIKey: VBCPVIWPDJVHAN-DIVICVDQSA-N.
| Molecular formula | C18H23Cl2NO |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | N-(2-chloroethyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-1-phenoxypropan-2-amine;hydrochloride |
| InChIKey | VBCPVIWPDJVHAN-DIVICVDQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CN(CCCl)C(C)COC2=CC=CC=C2)[2H])[2H].Cl |
Computed by PubChem (NCBI)