CAS 1398504-06-7 is the registry number for Trans-methyl 1-benzyl-4-(boc-amino)piperidine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl (3S,4S)-1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate (CAS 1398504-06-7) is a chemical compound with the molecular formula C19H28N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: methyl (3S,4S)-1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate. InChIKey: KSWAWCLGGIVDBA-HOTGVXAUSA-N.
| Molecular formula | C19H28N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | methyl (3S,4S)-1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate |
| InChIKey | KSWAWCLGGIVDBA-HOTGVXAUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(C[C@@H]1C(=O)OC)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)