CAS 139924-67-7 is the registry number for 2-(((Benzyloxy)carbonyl)amino)-3-(tritylthio)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid (CAS 139924-67-7) is a chemical compound with the molecular formula C30H27NO4S and a molecular weight of 497.6 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid. InChIKey: AXGBGCZDGIBZPI-HHHXNRCGSA-N.
| Molecular formula | C30H27NO4S |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid |
| InChIKey | AXGBGCZDGIBZPI-HHHXNRCGSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CSC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)