Products 139924-67-7

CAS 139924-67-7 is the registry number for 2-(((Benzyloxy)carbonyl)amino)-3-(tritylthio)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid (CAS 139924-67-7) is a chemical compound with the molecular formula C30H27NO4S and a molecular weight of 497.6 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid. InChIKey: AXGBGCZDGIBZPI-HHHXNRCGSA-N.

Identity
Molecular formulaC30H27NO4S
Molecular weight497.6 g/mol
IUPAC name(2S)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid
InChIKeyAXGBGCZDGIBZPI-HHHXNRCGSA-N
SMILESC1=CC=C(C=C1)COC(=O)N[C@H](CSC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O

Computed by PubChem (NCBI)